C15H22O2Si — CID 102324826
2-[(1S,4R,5R)-4-methoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]ethynyl-trimethylsilane (PubChem CID 102324826) has the molecular formula C15H22O2Si and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-[(1S,4R,5R)-4-methoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(1S,4R,5R)-4-methoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 102324826 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(1S,4R,5R)-4-methoxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]ethynyl-trimethylsilane |
| SMILES | CO[C@@H]1C(C#C[Si](C)(C)C)=C[C@]2(C)C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C15H22O2Si/c1-14-8-9-15(2,17-14)13(16-3)12(11-14)7-10-18(4,5)6/h8-9,11,13H,1-6H3/t13-,14+,15-/m1/s1 |
| InChIKey | QQBKACJAPATIQZ-QLFBSQMISA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|