C14H24OSi — CID 102011452
4-[(2S,3S,6R)-3,6-dimethyl-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane (PubChem CID 102011452) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is 4-[(2S,3S,6R)-3,6-dimethyl-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane.
| Compound Name | 4-[(2S,3S,6R)-3,6-dimethyl-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 102011452 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4-[(2S,3S,6R)-3,6-dimethyl-3,6-dihydro-2H-pyran-2-yl]but-1-ynyl-trimethylsilane |
| SMILES | C[C@@H]1C=C[C@H](C)[C@H](CCC#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C14H24OSi/c1-12-9-10-13(2)15-14(12)8-6-7-11-16(3,4)5/h9-10,12-14H,6,8H2,1-5H3/t12-,13+,14-/m0/s1 |
| InChIKey | KLDUXFUUVSOEBI-MJBXVCDLSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|