C13H22OSi — CID 101200205
trimethyl-[(6R)-1-oxaspiro[5.5]undeca-3,9-dien-9-yl]silane (PubChem CID 101200205) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is trimethyl-[(6R)-1-oxaspiro[5.5]undeca-3,9-dien-9-yl]silane.
| Compound Name | trimethyl-[(6R)-1-oxaspiro[5.5]undeca-3,9-dien-9-yl]silane |
|---|---|
| PubChem CID | 101200205 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | trimethyl-[(6R)-1-oxaspiro[5.5]undeca-3,9-dien-9-yl]silane |
| SMILES | C[Si](C)(C)C1=CC[C@]2(CC=CCO2)CC1 |
| InChI | InChI=1S/C13H22OSi/c1-15(2,3)12-6-9-13(10-7-12)8-4-5-11-14-13/h4-6H,7-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | PPEBFTOQORNVPP-CYBMUJFWSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|