C62H72Cl2N2O6S — CID 102324846
3-N,7-N-bis(4-chlorophenyl)-3-N,7-N-bis[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexyl]phenyl]-2,6-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine (PubChem CID 102324846) has the molecular formula C62H72Cl2N2O6S and a molecular weight of 1044.24 g/mol. Its IUPAC name is 3-N,7-N-bis(4-chlorophenyl)-3-N,7-N-bis[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexyl]phenyl]-2,6-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine.
| Compound Name | 3-N,7-N-bis(4-chlorophenyl)-3-N,7-N-bis[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexyl]phenyl]-2,6-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine |
|---|---|
| PubChem CID | 102324846 |
| Molecular Formula | C62H72Cl2N2O6S |
| Molecular Weight | 1044.24 g/mol |
| Exact Mass | 1042.45 |
| IUPAC Name | 3-N,7-N-bis(4-chlorophenyl)-3-N,7-N-bis[4-[6-[(3-ethyloxetan-3-yl)methoxy]hexyl]phenyl]-2,6-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine |
| SMILES | CCC1(COCCCCCCc2ccc(N(c3ccc(Cl)cc3)c3cc4c(cc3C)-c3ccc(N(c5ccc(Cl)cc5)c5ccc(CCCCCCOCC6(CC)COC6)cc5)c(C)c3S4(=O)=O)cc2)COC1 |
| InChI | InChI=1S/C62H72Cl2N2O6S/c1-5-61(41-71-42-61)39-69-35-13-9-7-11-15-47-17-25-51(26-18-47)65(53-29-21-49(63)22-30-53)57-34-33-55-56-37-45(3)58(38-59(56)73(67,68)60(55)46(57)4)66(54-31-23-50(64)24-32-54)52-27-19-48(20-28-52)16-12-8-10-14-36-70-40-62(6-2)43-72-44-62/h17-34,37-38H,5-16,35-36,39-44H2,1-4H3 |
| InChIKey | XQENTAAXJDFBPS-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.24 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|