C58H64Br5NO3 — CID 157086780
3-[6-[(4-bromophenyl)methoxy]hexoxymethyl]-3-ethyloxetane;4-octylaniline;2,2',7,7'-tetrabromo-9,9'-spirobi[fluorene] (PubChem CID 157086780) has the molecular formula C58H64Br5NO3 and a molecular weight of 1222.67 g/mol. Its IUPAC name is 3-[6-[(4-bromophenyl)methoxy]hexoxymethyl]-3-ethyloxetane;4-octylaniline;2,2',7,7'-tetrabromo-9,9'-spirobi[fluorene].
| Compound Name | 3-[6-[(4-bromophenyl)methoxy]hexoxymethyl]-3-ethyloxetane;4-octylaniline;2,2',7,7'-tetrabromo-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 157086780 |
| Molecular Formula | C58H64Br5NO3 |
| Molecular Weight | 1222.67 g/mol |
| Exact Mass | 1217.08 |
| IUPAC Name | 3-[6-[(4-bromophenyl)methoxy]hexoxymethyl]-3-ethyloxetane;4-octylaniline;2,2',7,7'-tetrabromo-9,9'-spirobi[fluorene] |
| SMILES | Brc1ccc2c(c1)C1(c3cc(Br)ccc3-2)c2cc(Br)ccc2-c2ccc(Br)cc21.CCC1(COCCCCCCOCc2ccc(Br)cc2)COC1.CCCCCCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C25H12Br4.C19H29BrO3.C14H23N/c26-13-1-5-17-18-6-2-14(27)10-22(18)25(21(17)9-13)23-11-15(28)3-7-19(23)20-8-4-16(29)12-24(20)25;1-2-19(15-23-16-19)14-22-12-6-4-3-5-11-21-13-17-7-9-18(20)10-8-17;1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h1-12H;7-10H,2-6,11-16H2,1H3;9-12H,2-8,15H2,1H3 |
| InChIKey | AEEJAFDHWOHKRF-UHFFFAOYSA-N |
| XLogP | 18.22 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1222.67 |
| LogP ≤ 5 | 18.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|