C27H37NO8 — CID 102325407
1-O-tert-butyl 6-O,7-O-dimethyl (2S,3S,6S,7S)-2-benzyl-3-(methoxymethoxy)-3,4,5,6,7,8-hexahydro-2H-quinoline-1,6,7-tricarboxylate (PubChem CID 102325407) has the molecular formula C27H37NO8 and a molecular weight of 503.59 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O,7-O-dimethyl (2S,3S,6S,7S)-2-benzyl-3-(methoxymethoxy)-3,4,5,6,7,8-hexahydro-2H-quinoline-1,6,7-tricarboxylate.
| Compound Name | 1-O-tert-butyl 6-O,7-O-dimethyl (2S,3S,6S,7S)-2-benzyl-3-(methoxymethoxy)-3,4,5,6,7,8-hexahydro-2H-quinoline-1,6,7-tricarboxylate |
|---|---|
| PubChem CID | 102325407 |
| Molecular Formula | C27H37NO8 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 1-O-tert-butyl 6-O,7-O-dimethyl (2S,3S,6S,7S)-2-benzyl-3-(methoxymethoxy)-3,4,5,6,7,8-hexahydro-2H-quinoline-1,6,7-tricarboxylate |
| SMILES | COCO[C@H]1CC2=C(C[C@H](C(=O)OC)[C@@H](C(=O)OC)C2)N(C(=O)OC(C)(C)C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H37NO8/c1-27(2,3)36-26(31)28-21-15-20(25(30)34-6)19(24(29)33-5)13-18(21)14-23(35-16-32-4)22(28)12-17-10-8-7-9-11-17/h7-11,19-20,22-23H,12-16H2,1-6H3/t19-,20-,22-,23-/m0/s1 |
| InChIKey | LQNZGQZBYSHHOY-SQOUVECCSA-N |
| XLogP | 3.85 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|