C16H26O4Si2 — CID 102325497
hydroxy-[4-[hydroxy(dimethyl)silyl]-2,5-bis(prop-2-enoxy)phenyl]-dimethylsilane (PubChem CID 102325497) has the molecular formula C16H26O4Si2 and a molecular weight of 338.55 g/mol. Its IUPAC name is hydroxy-[4-[hydroxy(dimethyl)silyl]-2,5-bis(prop-2-enoxy)phenyl]-dimethylsilane.
| Compound Name | hydroxy-[4-[hydroxy(dimethyl)silyl]-2,5-bis(prop-2-enoxy)phenyl]-dimethylsilane |
|---|---|
| PubChem CID | 102325497 |
| Molecular Formula | C16H26O4Si2 |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | hydroxy-[4-[hydroxy(dimethyl)silyl]-2,5-bis(prop-2-enoxy)phenyl]-dimethylsilane |
| SMILES | C=CCOc1cc([Si](C)(C)O)c(OCC=C)cc1[Si](C)(C)O |
| InChI | InChI=1S/C16H26O4Si2/c1-7-9-19-13-11-16(22(5,6)18)14(20-10-8-2)12-15(13)21(3,4)17/h7-8,11-12,17-18H,1-2,9-10H2,3-6H3 |
| InChIKey | YVDJSFQZILKAQO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|