C6H11NO10P2 — CID 102326025
2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid (PubChem CID 102326025) has the molecular formula C6H11NO10P2 and a molecular weight of 319.10 g/mol. Its IUPAC name is 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid |
|---|---|
| PubChem CID | 102326025 |
| Molecular Formula | C6H11NO10P2 |
| Molecular Weight | 319.10 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid |
| SMILES | O=C(O)CN(C=C(P(=O)(O)O)P(=O)(O)O)CC(=O)O |
| InChI | InChI=1S/C6H11NO10P2/c8-4(9)1-7(2-5(10)11)3-6(18(12,13)14)19(15,16)17/h3H,1-2H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | WRRVMOYBAIEUGZ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 192.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.10 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|