2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid

C6H11NO10P2 — CID 102326025

IUPAC2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid
SMILESO=C(O)CN(C=C(P(=O)(O)O)P(=O)(O)O)CC(=O)O
InChIInChI=1S/C6H11NO10P2/c8-4(9)1-7(2-5(10)11)3-6(18(12,13)14)19(15,16)17/h3H,1-2H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17)
InChIKeyWRRVMOYBAIEUGZ-UHFFFAOYSA-N
MW319.10 g/mol
LogP-1.39
Rot. Bonds7

About 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid

2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid (PubChem CID 102326025) has the molecular formula C6H11NO10P2 and a molecular weight of 319.10 g/mol. Its IUPAC name is 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid.

Molecular Properties

Compound Name2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid
PubChem CID102326025
Molecular FormulaC6H11NO10P2
Molecular Weight319.10 g/mol
Exact Mass318.99
IUPAC Name2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid
SMILESO=C(O)CN(C=C(P(=O)(O)O)P(=O)(O)O)CC(=O)O
InChIInChI=1S/C6H11NO10P2/c8-4(9)1-7(2-5(10)11)3-6(18(12,13)14)19(15,16)17/h3H,1-2H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17)
InChIKeyWRRVMOYBAIEUGZ-UHFFFAOYSA-N
XLogP-1.39
TPSA192.90 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500319.10
LogP ≤ 5-1.39
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid?
The IUPAC name of 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid (CID 102326025) is 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid.
What is the SMILES notation for 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid?
The canonical SMILES for 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid is O=C(O)CN(C=C(P(=O)(O)O)P(=O)(O)O)CC(=O)O.
What is the InChIKey of 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid?
The InChIKey is WRRVMOYBAIEUGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO10P2/c8-4(9)1-7(2-5(10)11)3-6(18(12,13)14)19(15,16)17/h3H,1-2H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17).
What are the key properties of 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid?
2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid has a molecular weight of 319.10 g/mol, XLogP of -1.39, 7 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxymethyl(2,2-diphosphonoethenyl)amino]acetic acid is sourced from PubChem (CID 102326025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).