C8H17NO13P2 — CID 175054522
2-[bis(carboxymethyl)amino]acetic acid;(2-hydroxy-1-phosphonoethyl)phosphonic acid (PubChem CID 175054522) has the molecular formula C8H17NO13P2 and a molecular weight of 397.17 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]acetic acid;(2-hydroxy-1-phosphonoethyl)phosphonic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]acetic acid;(2-hydroxy-1-phosphonoethyl)phosphonic acid |
|---|---|
| PubChem CID | 175054522 |
| Molecular Formula | C8H17NO13P2 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]acetic acid;(2-hydroxy-1-phosphonoethyl)phosphonic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)O.O=P(O)(O)C(CO)P(=O)(O)O |
| InChI | InChI=1S/C6H9NO6.C2H8O7P2/c8-4(9)1-7(2-5(10)11)3-6(12)13;3-1-2(10(4,5)6)11(7,8)9/h1-3H2,(H,8,9)(H,10,11)(H,12,13);2-3H,1H2,(H2,4,5,6)(H2,7,8,9) |
| InChIKey | WNOCLLSUXDARPZ-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 250.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|