C12H18O — CID 102326052
(4aS,8aS)-8a-prop-2-enyl-4,4a,5,6,7,8-hexahydrochromene (PubChem CID 102326052) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (4aS,8aS)-8a-prop-2-enyl-4,4a,5,6,7,8-hexahydrochromene.
| Compound Name | (4aS,8aS)-8a-prop-2-enyl-4,4a,5,6,7,8-hexahydrochromene |
|---|---|
| PubChem CID | 102326052 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (4aS,8aS)-8a-prop-2-enyl-4,4a,5,6,7,8-hexahydrochromene |
| SMILES | C=CC[C@@]12CCCC[C@H]1CC=CO2 |
| InChI | InChI=1S/C12H18O/c1-2-8-12-9-4-3-6-11(12)7-5-10-13-12/h2,5,10-11H,1,3-4,6-9H2/t11-,12+/m0/s1 |
| InChIKey | NBULWDYTFIEVDC-NWDGAFQWSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|