C10H16O — CID 101495860
(3R,4R)-4-prop-2-enyl-1-oxaspiro[2.5]octane (PubChem CID 101495860) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (3R,4R)-4-prop-2-enyl-1-oxaspiro[2.5]octane.
| Compound Name | (3R,4R)-4-prop-2-enyl-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 101495860 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (3R,4R)-4-prop-2-enyl-1-oxaspiro[2.5]octane |
| SMILES | C=CC[C@H]1CCCC[C@]12CO2 |
| InChI | InChI=1S/C10H16O/c1-2-5-9-6-3-4-7-10(9)8-11-10/h2,9H,1,3-8H2/t9-,10-/m0/s1 |
| InChIKey | HVFOIZNRCBYOPI-UWVGGRQHSA-N |
| XLogP | 2.52 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|