C11H18O — CID 86195362
4-cyclohexyl-3,4-dihydro-2H-pyran (PubChem CID 86195362) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-cyclohexyl-3,4-dihydro-2H-pyran.
| Compound Name | 4-cyclohexyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 86195362 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-cyclohexyl-3,4-dihydro-2H-pyran |
| SMILES | C1=CC(C2CCCCC2)CCO1 |
| InChI | InChI=1S/C11H18O/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h6,8,10-11H,1-5,7,9H2 |
| InChIKey | XJENTEYLUQWQDU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |