C11H18O — CID 134896061
(4S,7S)-4,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-isochromene (PubChem CID 134896061) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4S,7S)-4,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-isochromene.
| Compound Name | (4S,7S)-4,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-isochromene |
|---|---|
| PubChem CID | 134896061 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4S,7S)-4,7-dimethyl-4,4a,5,6,7,8-hexahydro-3H-isochromene |
| SMILES | C[C@H]1CCC2C(=COC[C@H]2C)C1 |
| InChI | InChI=1S/C11H18O/c1-8-3-4-11-9(2)6-12-7-10(11)5-8/h7-9,11H,3-6H2,1-2H3/t8-,9+,11?/m0/s1 |
| InChIKey | GZYAOXADQWRQDB-VUHGHZMFSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |