C13H24O — CID 66871588
4-ethyl-5-methyl-3-pentyl-3,4-dihydro-2H-pyran (PubChem CID 66871588) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is 4-ethyl-5-methyl-3-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 4-ethyl-5-methyl-3-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 66871588 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 4-ethyl-5-methyl-3-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1COC=C(C)C1CC |
| InChI | InChI=1S/C13H24O/c1-4-6-7-8-12-10-14-9-11(3)13(12)5-2/h9,12-13H,4-8,10H2,1-3H3 |
| InChIKey | PDSVHDJBGYSJJF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|