C18H32O3Si — CID 102326087
methyl 2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-bicyclo[4.1.0]hept-3-enyl]acetate (PubChem CID 102326087) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is methyl 2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-bicyclo[4.1.0]hept-3-enyl]acetate.
| Compound Name | methyl 2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-bicyclo[4.1.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 102326087 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | methyl 2-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-3-bicyclo[4.1.0]hept-3-enyl]acetate |
| SMILES | COC(=O)CC1=CC[C@]2(O[Si](C)(C)C(C)(C)C)[C@H](C1)C2(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-16(2,3)22(7,8)21-18-10-9-13(12-15(19)20-6)11-14(18)17(18,4)5/h9,14H,10-12H2,1-8H3/t14-,18+/m1/s1 |
| InChIKey | RGEXETMERDIHMB-KDOFPFPSSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|