C22H41N3O5 — CID 102326203
4-[bis[3-(3,3-dimethylbutanoylamino)propyl]amino]-4-oxobutanoic acid (PubChem CID 102326203) has the molecular formula C22H41N3O5 and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[bis[3-(3,3-dimethylbutanoylamino)propyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[bis[3-(3,3-dimethylbutanoylamino)propyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 102326203 |
| Molecular Formula | C22H41N3O5 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | 4-[bis[3-(3,3-dimethylbutanoylamino)propyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)CC(=O)NCCCN(CCCNC(=O)CC(C)(C)C)C(=O)CCC(=O)O |
| InChI | InChI=1S/C22H41N3O5/c1-21(2,3)15-17(26)23-11-7-13-25(19(28)9-10-20(29)30)14-8-12-24-18(27)16-22(4,5)6/h7-16H2,1-6H3,(H,23,26)(H,24,27)(H,29,30) |
| InChIKey | RSGKBCVWYAFSCW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|