C8H19N5O3 — CID 174740096
4-[bis(2-hydrazinylethyl)amino]-4-oxobutanoic acid (PubChem CID 174740096) has the molecular formula C8H19N5O3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-[bis(2-hydrazinylethyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[bis(2-hydrazinylethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174740096 |
| Molecular Formula | C8H19N5O3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-[bis(2-hydrazinylethyl)amino]-4-oxobutanoic acid |
| SMILES | NNCCN(CCNN)C(=O)CCC(=O)O |
| InChI | InChI=1S/C8H19N5O3/c9-11-3-5-13(6-4-12-10)7(14)1-2-8(15)16/h11-12H,1-6,9-10H2,(H,15,16) |
| InChIKey | MYEBCELYOYMUHE-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|