5-hydrazinylpentanoic acid

C5H12N2O2 — CID 175506840

IUPAC5-hydrazinylpentanoic acid
SMILESNNCCCCC(=O)O
InChIInChI=1S/C5H12N2O2/c6-7-4-2-1-3-5(8)9/h7H,1-4,6H2,(H,8,9)
InChIKeyPKRYOFJRCYDIRV-UHFFFAOYSA-N
MW132.16 g/mol
LogP-0.30
Rot. Bonds5

About 5-hydrazinylpentanoic acid

5-hydrazinylpentanoic acid (PubChem CID 175506840) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 5-hydrazinylpentanoic acid.

Molecular Properties

Compound Name5-hydrazinylpentanoic acid
PubChem CID175506840
Molecular FormulaC5H12N2O2
Molecular Weight132.16 g/mol
Exact Mass132.09
IUPAC Name5-hydrazinylpentanoic acid
SMILESNNCCCCC(=O)O
InChIInChI=1S/C5H12N2O2/c6-7-4-2-1-3-5(8)9/h7H,1-4,6H2,(H,8,9)
InChIKeyPKRYOFJRCYDIRV-UHFFFAOYSA-N
XLogP-0.30
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.16
LogP ≤ 5-0.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-hydrazinylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

butylhydrazine;octadecanoic acid
CID 159234519
7-hydrazinylheptanamide
CID 22099097
11-(2-hydrazinylhydrazinyl)undecanoic acid
CID 142469091
39-(2-hydrazinylhydrazinyl)nonatriacontanoic acid
CID 142420467
5-(methylamino)pentanoic acid
CID 91583432
11-[2-[2-[2-[2-(5-carboxypentylamino)ethylamino]ethylamino]ethylamino]ethylamino]undecanoic acid
CID 18956800
15-(3-carboxypropylamino)pentadecanoic acid
CID 87379366
14-(2-aminoethylamino)tetradecanoic acid
CID 173203671
12-hydrazinyldodecanamide;methanimine
CID 177324846
tetradecanedioic acid
CID 13185
decanedioic acid;tris(nonanedioic acid)
CID 159759294
decanedioic acid;hexanedioic acid;octanedioic acid
CID 159110511

Frequently Asked Questions

What is the IUPAC name of 5-hydrazinylpentanoic acid?
The IUPAC name of 5-hydrazinylpentanoic acid (CID 175506840) is 5-hydrazinylpentanoic acid.
What is the SMILES notation for 5-hydrazinylpentanoic acid?
The canonical SMILES for 5-hydrazinylpentanoic acid is NNCCCCC(=O)O.
What is the InChIKey of 5-hydrazinylpentanoic acid?
The InChIKey is PKRYOFJRCYDIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c6-7-4-2-1-3-5(8)9/h7H,1-4,6H2,(H,8,9).
What are the key properties of 5-hydrazinylpentanoic acid?
5-hydrazinylpentanoic acid has a molecular weight of 132.16 g/mol, XLogP of -0.30, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydrazinylpentanoic acid is sourced from PubChem (CID 175506840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).