About 7-hydrazinylheptanamide
7-hydrazinylheptanamide (PubChem CID 22099097) has the molecular formula C7H17N3O
and a molecular weight of 159.23 g/mol. Its IUPAC name is 7-hydrazinylheptanamide.
Molecular Properties
| Compound Name | 7-hydrazinylheptanamide |
| PubChem CID | 22099097 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 7-hydrazinylheptanamide |
| SMILES | NNCCCCCCC(N)=O |
| InChI | InChI=1S/C7H17N3O/c8-7(11)5-3-1-2-4-6-10-9/h10H,1-6,9H2,(H2,8,11) |
| InChIKey | LRKQRPJKWWTPNP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-hydrazinylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydrazinylheptanamide?
The IUPAC name of 7-hydrazinylheptanamide (CID 22099097) is 7-hydrazinylheptanamide.
What is the SMILES notation for 7-hydrazinylheptanamide?
The canonical SMILES for 7-hydrazinylheptanamide is NNCCCCCCC(N)=O.
What is the InChIKey of 7-hydrazinylheptanamide?
The InChIKey is LRKQRPJKWWTPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3O/c8-7(11)5-3-1-2-4-6-10-9/h10H,1-6,9H2,(H2,8,11).
What are the key properties of 7-hydrazinylheptanamide?
7-hydrazinylheptanamide has a molecular weight of 159.23 g/mol, XLogP of -0.11, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydrazinylheptanamide is sourced from PubChem (CID 22099097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).