C27H33Cl2N9O4 — CID 10232744
N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[5-[bis(2-chloroethyl)amino]-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-1-methylimidazole-2-carboxamide (PubChem CID 10232744) has the molecular formula C27H33Cl2N9O4 and a molecular weight of 618.53 g/mol. Its IUPAC name is N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[5-[bis(2-chloroethyl)amino]-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-1-methylimidazole-2-carboxamide.
| Compound Name | N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[5-[bis(2-chloroethyl)amino]-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 10232744 |
| Molecular Formula | C27H33Cl2N9O4 |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[5-[bis(2-chloroethyl)amino]-2,3-dihydro-1-benzofuran-2-carbonyl]amino]-1-methylimidazole-2-carboxamide |
| SMILES | [H]/N=C(\N)CCNC(=O)c1cc(NC(=O)c2nc(NC(=O)C3Cc4cc(N(CCCl)CCCl)ccc4O3)cn2C)cn1C |
| InChI | InChI=1S/C27H33Cl2N9O4/c1-36-14-17(13-19(36)25(39)32-8-5-22(30)31)33-27(41)24-34-23(15-37(24)2)35-26(40)21-12-16-11-18(3-4-20(16)42-21)38(9-6-28)10-7-29/h3-4,11,13-15,21H,5-10,12H2,1-2H3,(H3,30,31)(H,32,39)(H,33,41)(H,35,40) |
| InChIKey | FCORHDTWAHOZIP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 172.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|