C22H27Cl3N6O3 — CID 159253710
N-(3-amino-3-iminopropyl)-4-[[5-[bis(2-chloroethyl)amino]-1-benzofuran-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 159253710) has the molecular formula C22H27Cl3N6O3 and a molecular weight of 529.86 g/mol. Its IUPAC name is N-(3-amino-3-iminopropyl)-4-[[5-[bis(2-chloroethyl)amino]-1-benzofuran-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(3-amino-3-iminopropyl)-4-[[5-[bis(2-chloroethyl)amino]-1-benzofuran-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 159253710 |
| Molecular Formula | C22H27Cl3N6O3 |
| Molecular Weight | 529.86 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-(3-amino-3-iminopropyl)-4-[[5-[bis(2-chloroethyl)amino]-1-benzofuran-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CCNC(=O)c1cc(NC(=O)c2cc3cc(N(CCCl)CCCl)ccc3o2)cn1C |
| InChI | InChI=1S/C22H26Cl2N6O3.ClH/c1-29-13-15(12-17(29)21(31)27-7-4-20(25)26)28-22(32)19-11-14-10-16(2-3-18(14)33-19)30(8-5-23)9-6-24;/h2-3,10-13H,4-9H2,1H3,(H3,25,26)(H,27,31)(H,28,32);1H |
| InChIKey | LTILWOVRHPZMRX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|