C15H17ClO3 — CID 102328441
cis-ethyl (1R,2S)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylate (PubChem CID 102328441) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102328441 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | cis-ethyl (1R,2S)-2-(3-chlorobenzoyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H]1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H17ClO3/c1-2-19-15(18)13-8-4-7-12(13)14(17)10-5-3-6-11(16)9-10/h3,5-6,9,12-13H,2,4,7-8H2,1H3/t12-,13+/m0/s1 |
| InChIKey | LQADZQGFEOWMEJ-QWHCGFSZSA-N |
| XLogP | 3.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |