C36H33N3O — CID 102328531
2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine (PubChem CID 102328531) has the molecular formula C36H33N3O and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 102328531 |
| Molecular Formula | C36H33N3O |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C36H33N3O/c1-38(2)20-21-40-33-18-19-34-35(25-33)39(26-27-12-6-3-7-13-27)36(37-34)32-23-30(28-14-8-4-9-15-28)22-31(24-32)29-16-10-5-11-17-29/h3-19,22-25H,20-21,26H2,1-2H3 |
| InChIKey | NXMYUMNTLPDJRN-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |