About 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine
2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine (PubChem CID 102328531) has the molecular formula C36H33N3O
and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine |
| PubChem CID | 102328531 |
| Molecular Formula | C36H33N3O |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C36H33N3O/c1-38(2)20-21-40-33-18-19-34-35(25-33)39(26-27-12-6-3-7-13-27)36(37-34)32-23-30(28-14-8-4-9-15-28)22-31(24-32)29-16-10-5-11-17-29/h3-19,22-25H,20-21,26H2,1-2H3 |
| InChIKey | NXMYUMNTLPDJRN-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine?
The IUPAC name of 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine (CID 102328531) is 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine is CN(C)CCOc1ccc2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)n(Cc3ccccc3)c2c1.
What is the InChIKey of 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine?
The InChIKey is NXMYUMNTLPDJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H33N3O/c1-38(2)20-21-40-33-18-19-34-35(25-33)39(26-27-12-6-3-7-13-27)36(37-34)32-23-30(28-14-8-4-9-15-28)22-31(24-32)29-16-10-5-11-17-29/h3-19,22-25H,20-21,26H2,1-2H3.
What are the key properties of 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine?
2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine has a molecular weight of 523.68 g/mol, XLogP of 8.03, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-benzyl-2-(3,5-diphenylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylethanamine is sourced from PubChem (CID 102328531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).