C27H30BrN3O — CID 19353975
3-[3-[(2-bromophenyl)methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 19353975) has the molecular formula C27H30BrN3O and a molecular weight of 492.46 g/mol. Its IUPAC name is 3-[3-[(2-bromophenyl)methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[(2-bromophenyl)methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 19353975 |
| Molecular Formula | C27H30BrN3O |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[3-[(2-bromophenyl)methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | Cc1cc(C)cc(-c2nc3ccc(OCCCN(C)C)cc3n2Cc2ccccc2Br)c1 |
| InChI | InChI=1S/C27H30BrN3O/c1-19-14-20(2)16-22(15-19)27-29-25-11-10-23(32-13-7-12-30(3)4)17-26(25)31(27)18-21-8-5-6-9-24(21)28/h5-6,8-11,14-17H,7,12-13,18H2,1-4H3 |
| InChIKey | DLFXFRAKQCVYIP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|