C23H21BrN2O — CID 19354011
3-[[2-(bromomethyl)phenyl]methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-ol (PubChem CID 19354011) has the molecular formula C23H21BrN2O and a molecular weight of 421.34 g/mol. Its IUPAC name is 3-[[2-(bromomethyl)phenyl]methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-ol.
| Compound Name | 3-[[2-(bromomethyl)phenyl]methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-ol |
|---|---|
| PubChem CID | 19354011 |
| Molecular Formula | C23H21BrN2O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-[[2-(bromomethyl)phenyl]methyl]-2-(3,5-dimethylphenyl)benzimidazol-5-ol |
| SMILES | Cc1cc(C)cc(-c2nc3ccc(O)cc3n2Cc2ccccc2CBr)c1 |
| InChI | InChI=1S/C23H21BrN2O/c1-15-9-16(2)11-19(10-15)23-25-21-8-7-20(27)12-22(21)26(23)14-18-6-4-3-5-17(18)13-24/h3-12,27H,13-14H2,1-2H3 |
| InChIKey | GIUGXQUKMPVOOD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|