C15H26O3S2 — CID 102331673
(4aS,7S,10aR)-8,8-bis(ethylsulfanyl)-3,4,4a,6,7,9,10,10a-octahydro-2H-pyrano[3,2-b]oxocine-7-carbaldehyde (PubChem CID 102331673) has the molecular formula C15H26O3S2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (4aS,7S,10aR)-8,8-bis(ethylsulfanyl)-3,4,4a,6,7,9,10,10a-octahydro-2H-pyrano[3,2-b]oxocine-7-carbaldehyde.
| Compound Name | (4aS,7S,10aR)-8,8-bis(ethylsulfanyl)-3,4,4a,6,7,9,10,10a-octahydro-2H-pyrano[3,2-b]oxocine-7-carbaldehyde |
|---|---|
| PubChem CID | 102331673 |
| Molecular Formula | C15H26O3S2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (4aS,7S,10aR)-8,8-bis(ethylsulfanyl)-3,4,4a,6,7,9,10,10a-octahydro-2H-pyrano[3,2-b]oxocine-7-carbaldehyde |
| SMILES | CCSC1(SCC)CC[C@H]2OCCC[C@@H]2OC[C@H]1C=O |
| InChI | InChI=1S/C15H26O3S2/c1-3-19-15(20-4-2)8-7-14-13(6-5-9-17-14)18-11-12(15)10-16/h10,12-14H,3-9,11H2,1-2H3/t12-,13+,14-/m1/s1 |
| InChIKey | BURXIRVHNNLOBC-HZSPNIEDSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|