C12H20O2S2 — CID 102483782
2-[(8S)-10,10-dimethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]acetaldehyde (PubChem CID 102483782) has the molecular formula C12H20O2S2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-[(8S)-10,10-dimethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]acetaldehyde.
| Compound Name | 2-[(8S)-10,10-dimethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 102483782 |
| Molecular Formula | C12H20O2S2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[(8S)-10,10-dimethyl-9-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]acetaldehyde |
| SMILES | CC1(C)CC2(C[C@H](CC=O)O1)SCCCS2 |
| InChI | InChI=1S/C12H20O2S2/c1-11(2)9-12(15-6-3-7-16-12)8-10(14-11)4-5-13/h5,10H,3-4,6-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | OBYOBWYDCDQCFQ-JTQLQIEISA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|