C15H26O2S2 — CID 135044259
2-[(7R)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]acetaldehyde (PubChem CID 135044259) has the molecular formula C15H26O2S2 and a molecular weight of 302.50 g/mol. Its IUPAC name is 2-[(7R)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]acetaldehyde.
| Compound Name | 2-[(7R)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]acetaldehyde |
|---|---|
| PubChem CID | 135044259 |
| Molecular Formula | C15H26O2S2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[(7R)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]acetaldehyde |
| SMILES | CCCCC[C@H]1OC(CC=O)CCC12SCCCS2 |
| InChI | InChI=1S/C15H26O2S2/c1-2-3-4-6-14-15(18-11-5-12-19-15)9-7-13(17-14)8-10-16/h10,13-14H,2-9,11-12H2,1H3/t13?,14-/m1/s1 |
| InChIKey | XLQQKIZGILRTPT-ARLHGKGLSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|