C13H22O2S2 — CID 57332361
2-[(8R,10S,11R)-8-ethyl-11-methyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetaldehyde (PubChem CID 57332361) has the molecular formula C13H22O2S2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-[(8R,10S,11R)-8-ethyl-11-methyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetaldehyde.
| Compound Name | 2-[(8R,10S,11R)-8-ethyl-11-methyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetaldehyde |
|---|---|
| PubChem CID | 57332361 |
| Molecular Formula | C13H22O2S2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[(8R,10S,11R)-8-ethyl-11-methyl-9-oxa-1,5-dithiaspiro[5.5]undecan-10-yl]acetaldehyde |
| SMILES | CC[C@@H]1CC2(SCCCS2)[C@H](C)[C@H](CC=O)O1 |
| InChI | InChI=1S/C13H22O2S2/c1-3-11-9-13(16-7-4-8-17-13)10(2)12(15-11)5-6-14/h6,10-12H,3-5,7-9H2,1-2H3/t10-,11-,12+/m1/s1 |
| InChIKey | NSHLUEHBGDDXKI-UTUOFQBUSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|