C17H30O2S2 — CID 135030977
1-[(7R,9S)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]butan-2-one (PubChem CID 135030977) has the molecular formula C17H30O2S2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-[(7R,9S)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]butan-2-one.
| Compound Name | 1-[(7R,9S)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]butan-2-one |
|---|---|
| PubChem CID | 135030977 |
| Molecular Formula | C17H30O2S2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[(7R,9S)-7-pentyl-8-oxa-1,5-dithiaspiro[5.5]undecan-9-yl]butan-2-one |
| SMILES | CCCCC[C@H]1O[C@H](CC(=O)CC)CCC12SCCCS2 |
| InChI | InChI=1S/C17H30O2S2/c1-3-5-6-8-16-17(20-11-7-12-21-17)10-9-15(19-16)13-14(18)4-2/h15-16H,3-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | MTSSJBCVLUBMEP-JKSUJKDBSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|