C15H15KN2S2 — CID 102336342
potassium N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 102336342) has the molecular formula C15H15KN2S2 and a molecular weight of 326.53 g/mol. Its IUPAC name is potassium N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | potassium N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 102336342 |
| Molecular Formula | C15H15KN2S2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | potassium N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | S=C([S-])N(CCc1ccccc1)Cc1cccnc1.[K+] |
| InChI | InChI=1S/C15H16N2S2.K/c18-15(19)17(12-14-7-4-9-16-11-14)10-8-13-5-2-1-3-6-13;/h1-7,9,11H,8,10,12H2,(H,18,19);/q;+1/p-1 |
| InChIKey | FHUVEXXQXZRPDB-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|