C17H19KN2O3S2 — CID 122204871
potassium N-(pyridin-3-ylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]carbamodithioate (PubChem CID 122204871) has the molecular formula C17H19KN2O3S2 and a molecular weight of 402.58 g/mol. Its IUPAC name is potassium N-(pyridin-3-ylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]carbamodithioate.
| Compound Name | potassium N-(pyridin-3-ylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]carbamodithioate |
|---|---|
| PubChem CID | 122204871 |
| Molecular Formula | C17H19KN2O3S2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | potassium N-(pyridin-3-ylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]carbamodithioate |
| SMILES | COc1cc(CN(Cc2cccnc2)C(=S)[S-])cc(OC)c1OC.[K+] |
| InChI | InChI=1S/C17H20N2O3S2.K/c1-20-14-7-13(8-15(21-2)16(14)22-3)11-19(17(23)24)10-12-5-4-6-18-9-12;/h4-9H,10-11H2,1-3H3,(H,23,24);/q;+1/p-1 |
| InChIKey | AONQYZJJLRXDLX-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|