C29H46O2Si — CID 102336411
(3S,6aS,6bS,9R,11aS,11bR)-3-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethylspiro[2,3,4,6,6a,6b,7,8,11,11a-decahydro-1H-benzo[a]fluorene-9,3'-cyclopentane]-1'-one (PubChem CID 102336411) has the molecular formula C29H46O2Si and a molecular weight of 454.77 g/mol. Its IUPAC name is (3S,6aS,6bS,9R,11aS,11bR)-3-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethylspiro[2,3,4,6,6a,6b,7,8,11,11a-decahydro-1H-benzo[a]fluorene-9,3'-cyclopentane]-1'-one.
| Compound Name | (3S,6aS,6bS,9R,11aS,11bR)-3-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethylspiro[2,3,4,6,6a,6b,7,8,11,11a-decahydro-1H-benzo[a]fluorene-9,3'-cyclopentane]-1'-one |
|---|---|
| PubChem CID | 102336411 |
| Molecular Formula | C29H46O2Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (3S,6aS,6bS,9R,11aS,11bR)-3-[tert-butyl(dimethyl)silyl]oxy-10,11b-dimethylspiro[2,3,4,6,6a,6b,7,8,11,11a-decahydro-1H-benzo[a]fluorene-9,3'-cyclopentane]-1'-one |
| SMILES | CC1=C2C[C@H]3[C@@H](CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]43C)[C@@H]2CC[C@]12CCC(=O)C2 |
| InChI | InChI=1S/C29H46O2Si/c1-19-25-17-26-24(23(25)12-15-29(19)14-10-21(30)18-29)9-8-20-16-22(11-13-28(20,26)5)31-32(6,7)27(2,3)4/h8,22-24,26H,9-18H2,1-7H3/t22-,23-,24-,26-,28-,29-/m0/s1 |
| InChIKey | CUOWWKOMEFTPHH-WTHNENEGSA-N |
| XLogP | 8.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|