C21H10FN3O4 — CID 102336786
(3S)-2'-amino-7-fluoro-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carbonitrile (PubChem CID 102336786) has the molecular formula C21H10FN3O4 and a molecular weight of 387.33 g/mol. Its IUPAC name is (3S)-2'-amino-7-fluoro-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carbonitrile.
| Compound Name | (3S)-2'-amino-7-fluoro-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carbonitrile |
|---|---|
| PubChem CID | 102336786 |
| Molecular Formula | C21H10FN3O4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (3S)-2'-amino-7-fluoro-2,5',10'-trioxospiro[1H-indole-3,4'-benzo[g]chromene]-3'-carbonitrile |
| SMILES | N#CC1=C(N)OC2=C(C(=O)c3ccccc3C2=O)[C@@]12C(=O)Nc1c(F)cccc12 |
| InChI | InChI=1S/C21H10FN3O4/c22-13-7-3-6-11-15(13)25-20(28)21(11)12(8-23)19(24)29-18-14(21)16(26)9-4-1-2-5-10(9)17(18)27/h1-7H,24H2,(H,25,28)/t21-/m0/s1 |
| InChIKey | SOGLMHYPSFVIEG-NRFANRHFSA-N |
| XLogP | 2.07 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|