C28H23BrN2O5 — CID 102336850
dimethyl 1-(4-bromophenyl)-6-oxo-3-phenyl-2-[(E)-2-phenylethenyl]-2H-pyrimidine-4,5-dicarboxylate (PubChem CID 102336850) has the molecular formula C28H23BrN2O5 and a molecular weight of 547.41 g/mol. Its IUPAC name is dimethyl 1-(4-bromophenyl)-6-oxo-3-phenyl-2-[(E)-2-phenylethenyl]-2H-pyrimidine-4,5-dicarboxylate.
| Compound Name | dimethyl 1-(4-bromophenyl)-6-oxo-3-phenyl-2-[(E)-2-phenylethenyl]-2H-pyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102336850 |
| Molecular Formula | C28H23BrN2O5 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | dimethyl 1-(4-bromophenyl)-6-oxo-3-phenyl-2-[(E)-2-phenylethenyl]-2H-pyrimidine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2)C(/C=C/c2ccccc2)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C28H23BrN2O5/c1-35-27(33)24-25(28(34)36-2)30(21-11-7-4-8-12-21)23(18-13-19-9-5-3-6-10-19)31(26(24)32)22-16-14-20(29)15-17-22/h3-18,23H,1-2H3/b18-13+ |
| InChIKey | MXESSMHQVDWKKL-QGOAFFKASA-N |
| XLogP | 4.94 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|