C37H37N5O7S — CID 10233725
4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-[4-[(3-methoxyphenyl)methoxy]but-2-ynoxy]-2-pyrimidin-2-ylpyrimidin-4-yl]benzenesulfonamide (PubChem CID 10233725) has the molecular formula C37H37N5O7S and a molecular weight of 695.80 g/mol. Its IUPAC name is 4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-[4-[(3-methoxyphenyl)methoxy]but-2-ynoxy]-2-pyrimidin-2-ylpyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-[4-[(3-methoxyphenyl)methoxy]but-2-ynoxy]-2-pyrimidin-2-ylpyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10233725 |
| Molecular Formula | C37H37N5O7S |
| Molecular Weight | 695.80 g/mol |
| Exact Mass | 695.24 |
| IUPAC Name | 4-tert-butyl-N-[5-(2-methoxyphenoxy)-6-[4-[(3-methoxyphenyl)methoxy]but-2-ynoxy]-2-pyrimidin-2-ylpyrimidin-4-yl]benzenesulfonamide |
| SMILES | COc1cccc(COCC#CCOc2nc(-c3ncccn3)nc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2Oc2ccccc2OC)c1 |
| InChI | InChI=1S/C37H37N5O7S/c1-37(2,3)27-16-18-29(19-17-27)50(43,44)42-33-32(49-31-15-7-6-14-30(31)46-5)36(41-35(40-33)34-38-20-11-21-39-34)48-23-9-8-22-47-25-26-12-10-13-28(24-26)45-4/h6-7,10-21,24H,22-23,25H2,1-5H3,(H,40,41,42) |
| InChIKey | BOZRZLSGKYKORK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.80 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|