C22H32O3 — CID 102338404
[(1R,2R,4S,5S,6R,7S,10R,11S)-4-ethenyl-4,6,10,11-tetramethyl-12-oxo-5-tetracyclo[5.4.3.01,7.02,11]tetradecanyl] acetate (PubChem CID 102338404) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1R,2R,4S,5S,6R,7S,10R,11S)-4-ethenyl-4,6,10,11-tetramethyl-12-oxo-5-tetracyclo[5.4.3.01,7.02,11]tetradecanyl] acetate.
| Compound Name | [(1R,2R,4S,5S,6R,7S,10R,11S)-4-ethenyl-4,6,10,11-tetramethyl-12-oxo-5-tetracyclo[5.4.3.01,7.02,11]tetradecanyl] acetate |
|---|---|
| PubChem CID | 102338404 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(1R,2R,4S,5S,6R,7S,10R,11S)-4-ethenyl-4,6,10,11-tetramethyl-12-oxo-5-tetracyclo[5.4.3.01,7.02,11]tetradecanyl] acetate |
| SMILES | C=C[C@]1(C)C[C@@H]2[C@]3(C)[C@H](C)CC[C@]4(CCC(=O)[C@]243)[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H32O3/c1-7-19(5)12-16-20(6)13(2)8-10-21(11-9-17(24)22(16,20)21)14(3)18(19)25-15(4)23/h7,13-14,16,18H,1,8-12H2,2-6H3/t13-,14+,16-,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | JUHNVEQNLVTDDC-TXQMHFFJSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|