C23H36O7 — CID 164791033
[(4aS,7R,8aR,9R,10R,10aR)-7-ethenyl-4,4b,10,10a-tetrahydroxy-1,1,4a,7,8a-pentamethyl-5-oxo-3,4,6,8,9,10-hexahydro-2H-phenanthren-9-yl] acetate (PubChem CID 164791033) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is [(4aS,7R,8aR,9R,10R,10aR)-7-ethenyl-4,4b,10,10a-tetrahydroxy-1,1,4a,7,8a-pentamethyl-5-oxo-3,4,6,8,9,10-hexahydro-2H-phenanthren-9-yl] acetate.
| Compound Name | [(4aS,7R,8aR,9R,10R,10aR)-7-ethenyl-4,4b,10,10a-tetrahydroxy-1,1,4a,7,8a-pentamethyl-5-oxo-3,4,6,8,9,10-hexahydro-2H-phenanthren-9-yl] acetate |
|---|---|
| PubChem CID | 164791033 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [(4aS,7R,8aR,9R,10R,10aR)-7-ethenyl-4,4b,10,10a-tetrahydroxy-1,1,4a,7,8a-pentamethyl-5-oxo-3,4,6,8,9,10-hexahydro-2H-phenanthren-9-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)C2(O)[C@](C)(C1)[C@@H](OC(C)=O)[C@@H](O)[C@@]1(O)C(C)(C)CCC(O)[C@]21C |
| InChI | InChI=1S/C23H36O7/c1-8-19(5)11-15(26)22(28)20(6,12-19)17(30-13(2)24)16(27)23(29)18(3,4)10-9-14(25)21(22,23)7/h8,14,16-17,25,27-29H,1,9-12H2,2-7H3/t14?,16-,17+,19+,20-,21-,22?,23-/m1/s1 |
| InChIKey | FRHJOYNRHMGSDY-WLONHCHXSA-N |
| XLogP | 1.50 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|