C23H41NO12S — CID 102338741
[(2R,3S,4S,5S,6R)-2-[(2R,3S,4S,5R,6R)-3-acetyloxy-2-(5-aminopentylsulfanyl)-5-hydroxy-6-(2-hydroxyethyl)oxan-4-yl]oxy-4,5-dihydroxy-6-(2-hydroxyethyl)oxan-3-yl] acetate (PubChem CID 102338741) has the molecular formula C23H41NO12S and a molecular weight of 555.64 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-2-[(2R,3S,4S,5R,6R)-3-acetyloxy-2-(5-aminopentylsulfanyl)-5-hydroxy-6-(2-hydroxyethyl)oxan-4-yl]oxy-4,5-dihydroxy-6-(2-hydroxyethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-2-[(2R,3S,4S,5R,6R)-3-acetyloxy-2-(5-aminopentylsulfanyl)-5-hydroxy-6-(2-hydroxyethyl)oxan-4-yl]oxy-4,5-dihydroxy-6-(2-hydroxyethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102338741 |
| Molecular Formula | C23H41NO12S |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-2-[(2R,3S,4S,5R,6R)-3-acetyloxy-2-(5-aminopentylsulfanyl)-5-hydroxy-6-(2-hydroxyethyl)oxan-4-yl]oxy-4,5-dihydroxy-6-(2-hydroxyethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](CCO)O[C@H](SCCCCCN)[C@H]2OC(C)=O)O[C@H](CCO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H41NO12S/c1-12(27)32-20-18(31)16(29)14(6-9-25)34-22(20)36-19-17(30)15(7-10-26)35-23(21(19)33-13(2)28)37-11-5-3-4-8-24/h14-23,25-26,29-31H,3-11,24H2,1-2H3/t14-,15-,16-,17-,18+,19+,20+,21+,22-,23-/m1/s1 |
| InChIKey | SQURCJBQVGNOPP-LYSWRHGLSA-N |
| XLogP | -1.61 |
| TPSA | 207.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|