C13H27NO5S — CID 90672939
(2R,3S,4S,5S,6R)-2-(6-aminohexylsulfanyl)-6-(methoxymethyl)oxane-3,4,5-triol (PubChem CID 90672939) has the molecular formula C13H27NO5S and a molecular weight of 309.43 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(6-aminohexylsulfanyl)-6-(methoxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(6-aminohexylsulfanyl)-6-(methoxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90672939 |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(6-aminohexylsulfanyl)-6-(methoxymethyl)oxane-3,4,5-triol |
| SMILES | COC[C@H]1O[C@H](SCCCCCCN)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H27NO5S/c1-18-8-9-10(15)11(16)12(17)13(19-9)20-7-5-3-2-4-6-14/h9-13,15-17H,2-8,14H2,1H3/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | DPBOIKMAPOJGHS-NAWOPXAZSA-N |
| XLogP | -0.31 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|