C15H15NO2 — CID 102338825
6-(furan-2-yl)-4-methyl-2-phenyl-3,6-dihydrooxazine (PubChem CID 102338825) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 6-(furan-2-yl)-4-methyl-2-phenyl-3,6-dihydrooxazine.
| Compound Name | 6-(furan-2-yl)-4-methyl-2-phenyl-3,6-dihydrooxazine |
|---|---|
| PubChem CID | 102338825 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-(furan-2-yl)-4-methyl-2-phenyl-3,6-dihydrooxazine |
| SMILES | CC1=CC(c2ccco2)ON(c2ccccc2)C1 |
| InChI | InChI=1S/C15H15NO2/c1-12-10-15(14-8-5-9-17-14)18-16(11-12)13-6-3-2-4-7-13/h2-10,15H,11H2,1H3 |
| InChIKey | HTWDXKYOMGGTRM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|