C24H18O4 — CID 102339183
1-(3,6,8-triacetylpyren-1-yl)ethanone (PubChem CID 102339183) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is 1-(3,6,8-triacetylpyren-1-yl)ethanone.
| Compound Name | 1-(3,6,8-triacetylpyren-1-yl)ethanone |
|---|---|
| PubChem CID | 102339183 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-(3,6,8-triacetylpyren-1-yl)ethanone |
| SMILES | CC(=O)c1cc(C(C)=O)c2ccc3c(C(C)=O)cc(C(C)=O)c4ccc1c2c43 |
| InChI | InChI=1S/C24H18O4/c1-11(25)19-9-20(12(2)26)16-7-8-18-22(14(4)28)10-21(13(3)27)17-6-5-15(19)23(16)24(17)18/h5-10H,1-4H3 |
| InChIKey | LJEYERVJYRUKPJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|