C10H10FNO — CID 102340041
5-(fluoromethyl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 102340041) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 5-(fluoromethyl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(fluoromethyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 102340041 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-(fluoromethyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | FCC1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C10H10FNO/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | HFPNAXUVDJSEEI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |