C18H28O2 — CID 102340399
2-ethyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-2-pentylfuran-3-one (PubChem CID 102340399) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-ethyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-2-pentylfuran-3-one.
| Compound Name | 2-ethyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-2-pentylfuran-3-one |
|---|---|
| PubChem CID | 102340399 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-ethyl-5-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-2-pentylfuran-3-one |
| SMILES | CC/C=C/C=C/C1=C(C)C(=O)C(CC)(CCCCC)O1 |
| InChI | InChI=1S/C18H28O2/c1-5-8-10-11-13-16-15(4)17(19)18(7-3,20-16)14-12-9-6-2/h8,10-11,13H,5-7,9,12,14H2,1-4H3/b10-8+,13-11+ |
| InChIKey | VHXULTBUDHFQOP-HATNNVTISA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|