C23H20N4O2Se — CID 102341170
N-(2-methoxyphenyl)-5-methyl-1-(2-phenylselanylphenyl)triazole-4-carboxamide (PubChem CID 102341170) has the molecular formula C23H20N4O2Se and a molecular weight of 463.40 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-5-methyl-1-(2-phenylselanylphenyl)triazole-4-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-5-methyl-1-(2-phenylselanylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 102341170 |
| Molecular Formula | C23H20N4O2Se |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-(2-methoxyphenyl)-5-methyl-1-(2-phenylselanylphenyl)triazole-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1nnn(-c2ccccc2[Se]c2ccccc2)c1C |
| InChI | InChI=1S/C23H20N4O2Se/c1-16-22(23(28)24-18-12-6-8-14-20(18)29-2)25-26-27(16)19-13-7-9-15-21(19)30-17-10-4-3-5-11-17/h3-15H,1-2H3,(H,24,28) |
| InChIKey | INNUZJMAIDPYGD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|