C20H26N2OS — CID 102342006
4-(2-decoxy-1,3-thiazol-5-yl)benzonitrile (PubChem CID 102342006) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-(2-decoxy-1,3-thiazol-5-yl)benzonitrile.
| Compound Name | 4-(2-decoxy-1,3-thiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 102342006 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-(2-decoxy-1,3-thiazol-5-yl)benzonitrile |
| SMILES | CCCCCCCCCCOc1ncc(-c2ccc(C#N)cc2)s1 |
| InChI | InChI=1S/C20H26N2OS/c1-2-3-4-5-6-7-8-9-14-23-20-22-16-19(24-20)18-12-10-17(15-21)11-13-18/h10-13,16H,2-9,14H2,1H3 |
| InChIKey | AYIRWOYIQYZUCT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|