C9H11NO3 — CID 102342995
(8aS)-8a-hydroxy-5,6,7,8-tetrahydroisoquinoline-1,3-dione (PubChem CID 102342995) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (8aS)-8a-hydroxy-5,6,7,8-tetrahydroisoquinoline-1,3-dione.
| Compound Name | (8aS)-8a-hydroxy-5,6,7,8-tetrahydroisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102342995 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (8aS)-8a-hydroxy-5,6,7,8-tetrahydroisoquinoline-1,3-dione |
| SMILES | O=C1C=C2CCCC[C@@]2(O)C(=O)N1 |
| InChI | InChI=1S/C9H11NO3/c11-7-5-6-3-1-2-4-9(6,13)8(12)10-7/h5,13H,1-4H2,(H,10,11,12)/t9-/m0/s1 |
| InChIKey | VYYIKYAYXVBAOK-VIFPVBQESA-N |
| XLogP | -0.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|