C28H22FNO2S — CID 102343066
N-(7-fluoro-2,3-diphenyl-1H-inden-1-yl)-4-methylbenzenesulfonamide (PubChem CID 102343066) has the molecular formula C28H22FNO2S and a molecular weight of 455.55 g/mol. Its IUPAC name is N-(7-fluoro-2,3-diphenyl-1H-inden-1-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(7-fluoro-2,3-diphenyl-1H-inden-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102343066 |
| Molecular Formula | C28H22FNO2S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-(7-fluoro-2,3-diphenyl-1H-inden-1-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2C(c3ccccc3)=C(c3ccccc3)c3cccc(F)c32)cc1 |
| InChI | InChI=1S/C28H22FNO2S/c1-19-15-17-22(18-16-19)33(31,32)30-28-26(21-11-6-3-7-12-21)25(20-9-4-2-5-10-20)23-13-8-14-24(29)27(23)28/h2-18,28,30H,1H3 |
| InChIKey | CAPRMASMMDNPSS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|