C28H24N8O — CID 102343109
2-[[6-amino-8-(4-aminophenyl)purin-9-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 102343109) has the molecular formula C28H24N8O and a molecular weight of 488.56 g/mol. Its IUPAC name is 2-[[6-amino-8-(4-aminophenyl)purin-9-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[[6-amino-8-(4-aminophenyl)purin-9-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 102343109 |
| Molecular Formula | C28H24N8O |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[[6-amino-8-(4-aminophenyl)purin-9-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(Cn2c(-c3ccc(N)cc3)nc3c(N)ncnc32)nc2cccc(C)c2c1=O |
| InChI | InChI=1S/C28H24N8O/c1-16-6-3-4-9-21(16)36-22(33-20-8-5-7-17(2)23(20)28(36)37)14-35-26(18-10-12-19(29)13-11-18)34-24-25(30)31-15-32-27(24)35/h3-13,15H,14,29H2,1-2H3,(H2,30,31,32) |
| InChIKey | JSUCOUCNKYDIEY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|