C26H24N8O — CID 145494611
2-[[4-amino-3-[2-(dimethylamino)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 145494611) has the molecular formula C26H24N8O and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[[4-amino-3-[2-(dimethylamino)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[[4-amino-3-[2-(dimethylamino)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 145494611 |
| Molecular Formula | C26H24N8O |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[[4-amino-3-[2-(dimethylamino)ethynyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(Cn2nc(C#CN(C)C)c3c(N)ncnc32)nc2cccc(C)c2c1=O |
| InChI | InChI=1S/C26H24N8O/c1-16-8-5-6-11-20(16)34-21(30-18-10-7-9-17(2)22(18)26(34)35)14-33-25-23(24(27)28-15-29-25)19(31-33)12-13-32(3)4/h5-11,15H,14H2,1-4H3,(H2,27,28,29) |
| InChIKey | QEXIMEDOEUMEGA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|